C14H12Br2ClN — CID 107597207
2,6-dibromo-N-[(3-chloro-4-methylphenyl)methyl]aniline (PubChem CID 107597207) has the molecular formula C14H12Br2ClN and a molecular weight of 389.52 g/mol. Its IUPAC name is 2,6-dibromo-N-[(3-chloro-4-methylphenyl)methyl]aniline.
| Compound Name | 2,6-dibromo-N-[(3-chloro-4-methylphenyl)methyl]aniline |
|---|---|
| PubChem CID | 107597207 |
| Molecular Formula | C14H12Br2ClN |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 386.90 |
| IUPAC Name | 2,6-dibromo-N-[(3-chloro-4-methylphenyl)methyl]aniline |
| SMILES | Cc1ccc(CNc2c(Br)cccc2Br)cc1Cl |
| InChI | InChI=1S/C14H12Br2ClN/c1-9-5-6-10(7-13(9)17)8-18-14-11(15)3-2-4-12(14)16/h2-7,18H,8H2,1H3 |
| InChIKey | OQOAQDBRKBCSJD-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |