C15H13BrFNO2 — CID 107598516
N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-bromo-6-fluoroaniline (PubChem CID 107598516) has the molecular formula C15H13BrFNO2 and a molecular weight of 338.18 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-bromo-6-fluoroaniline.
| Compound Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-bromo-6-fluoroaniline |
|---|---|
| PubChem CID | 107598516 |
| Molecular Formula | C15H13BrFNO2 |
| Molecular Weight | 338.18 g/mol |
| Exact Mass | 337.01 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-bromo-6-fluoroaniline |
| SMILES | CC(Nc1c(F)cccc1Br)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H13BrFNO2/c1-9(18-15-11(16)3-2-4-12(15)17)10-5-6-13-14(7-10)20-8-19-13/h2-7,9,18H,8H2,1H3 |
| InChIKey | RSSHFSVAKFAWGD-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.18 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |