C15H12Br2N2O — CID 107598960
4-[2-(2,6-dibromoanilino)-1-hydroxyethyl]benzonitrile (PubChem CID 107598960) has the molecular formula C15H12Br2N2O and a molecular weight of 396.08 g/mol. Its IUPAC name is 4-[2-(2,6-dibromoanilino)-1-hydroxyethyl]benzonitrile.
| Compound Name | 4-[2-(2,6-dibromoanilino)-1-hydroxyethyl]benzonitrile |
|---|---|
| PubChem CID | 107598960 |
| Molecular Formula | C15H12Br2N2O |
| Molecular Weight | 396.08 g/mol |
| Exact Mass | 393.93 |
| IUPAC Name | 4-[2-(2,6-dibromoanilino)-1-hydroxyethyl]benzonitrile |
| SMILES | N#Cc1ccc(C(O)CNc2c(Br)cccc2Br)cc1 |
| InChI | InChI=1S/C15H12Br2N2O/c16-12-2-1-3-13(17)15(12)19-9-14(20)11-6-4-10(8-18)5-7-11/h1-7,14,19-20H,9H2 |
| InChIKey | BTMUEKISPFKSDQ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.08 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |