C12H14Br2N2O — CID 107599756
N-(2,6-dibromophenyl)-2-methylpyrrolidine-3-carboxamide (PubChem CID 107599756) has the molecular formula C12H14Br2N2O and a molecular weight of 362.07 g/mol. Its IUPAC name is N-(2,6-dibromophenyl)-2-methylpyrrolidine-3-carboxamide.
| Compound Name | N-(2,6-dibromophenyl)-2-methylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 107599756 |
| Molecular Formula | C12H14Br2N2O |
| Molecular Weight | 362.07 g/mol |
| Exact Mass | 359.95 |
| IUPAC Name | N-(2,6-dibromophenyl)-2-methylpyrrolidine-3-carboxamide |
| SMILES | CC1NCCC1C(=O)Nc1c(Br)cccc1Br |
| InChI | InChI=1S/C12H14Br2N2O/c1-7-8(5-6-15-7)12(17)16-11-9(13)3-2-4-10(11)14/h2-4,7-8,15H,5-6H2,1H3,(H,16,17) |
| InChIKey | DAODDPVMCSFPAO-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.07 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |