C21H30O4 — CID 10760017
methyl (4R,6R,9E,13E,15S)-4,13,18-trimethyl-5,16-dioxatricyclo[13.3.0.04,6]octadeca-1(18),9,13-triene-9-carboxylate (PubChem CID 10760017) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is methyl (4R,6R,9E,13E,15S)-4,13,18-trimethyl-5,16-dioxatricyclo[13.3.0.04,6]octadeca-1(18),9,13-triene-9-carboxylate.
| Compound Name | methyl (4R,6R,9E,13E,15S)-4,13,18-trimethyl-5,16-dioxatricyclo[13.3.0.04,6]octadeca-1(18),9,13-triene-9-carboxylate |
|---|---|
| PubChem CID | 10760017 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | methyl (4R,6R,9E,13E,15S)-4,13,18-trimethyl-5,16-dioxatricyclo[13.3.0.04,6]octadeca-1(18),9,13-triene-9-carboxylate |
| SMILES | COC(=O)/C1=C/CC/C(C)=C/[C@@H]2OCC(C)=C2CC[C@@]2(C)O[C@@H]2CC1 |
| InChI | InChI=1S/C21H30O4/c1-14-6-5-7-16(20(22)23-4)8-9-19-21(3,25-19)11-10-17-15(2)13-24-18(17)12-14/h7,12,18-19H,5-6,8-11,13H2,1-4H3/b14-12+,16-7+/t18-,19+,21+/m0/s1 |
| InChIKey | NVBLQPUZABQFTK-KFWMYXOISA-N |
| XLogP | 4.26 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|