C22H34O3 — CID 10760029
[(2E,6E)-3-formyl-7-methyl-9-[(1S)-2,6,6-trimethylcyclohex-2-en-1-yl]nona-2,6-dienyl] acetate (PubChem CID 10760029) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is [(2E,6E)-3-formyl-7-methyl-9-[(1S)-2,6,6-trimethylcyclohex-2-en-1-yl]nona-2,6-dienyl] acetate.
| Compound Name | [(2E,6E)-3-formyl-7-methyl-9-[(1S)-2,6,6-trimethylcyclohex-2-en-1-yl]nona-2,6-dienyl] acetate |
|---|---|
| PubChem CID | 10760029 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | [(2E,6E)-3-formyl-7-methyl-9-[(1S)-2,6,6-trimethylcyclohex-2-en-1-yl]nona-2,6-dienyl] acetate |
| SMILES | CC(=O)OC/C=C(/C=O)CC/C=C(\C)CC[C@@H]1C(C)=CCCC1(C)C |
| InChI | InChI=1S/C22H34O3/c1-17(8-6-10-20(16-23)13-15-25-19(3)24)11-12-21-18(2)9-7-14-22(21,4)5/h8-9,13,16,21H,6-7,10-12,14-15H2,1-5H3/b17-8+,20-13+/t21-/m1/s1 |
| InChIKey | BBJXCCLPNQVQPA-PZGBOPBDSA-N |
| XLogP | 5.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|