C13H10Br2N2S — CID 107600507
2-(2,6-dibromoanilino)benzenecarbothioamide (PubChem CID 107600507) has the molecular formula C13H10Br2N2S and a molecular weight of 386.11 g/mol. Its IUPAC name is 2-(2,6-dibromoanilino)benzenecarbothioamide.
| Compound Name | 2-(2,6-dibromoanilino)benzenecarbothioamide |
|---|---|
| PubChem CID | 107600507 |
| Molecular Formula | C13H10Br2N2S |
| Molecular Weight | 386.11 g/mol |
| Exact Mass | 383.89 |
| IUPAC Name | 2-(2,6-dibromoanilino)benzenecarbothioamide |
| SMILES | NC(=S)c1ccccc1Nc1c(Br)cccc1Br |
| InChI | InChI=1S/C13H10Br2N2S/c14-9-5-3-6-10(15)12(9)17-11-7-2-1-4-8(11)13(16)18/h1-7,17H,(H2,16,18) |
| InChIKey | OFBIPMCFJMKYBK-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.11 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|