About [(E)-hex-2-enyl] N-[4-(trifluoromethyl)phenyl]benzenecarboximidate
[(E)-hex-2-enyl] N-[4-(trifluoromethyl)phenyl]benzenecarboximidate (PubChem CID 10760059) has the molecular formula C20H20F3NO
and a molecular weight of 347.38 g/mol. Its IUPAC name is [(E)-hex-2-enyl] N-[4-(trifluoromethyl)phenyl]benzenecarboximidate.
Molecular Properties
| Compound Name | [(E)-hex-2-enyl] N-[4-(trifluoromethyl)phenyl]benzenecarboximidate |
| PubChem CID | 10760059 |
| Molecular Formula | C20H20F3NO |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | [(E)-hex-2-enyl] N-[4-(trifluoromethyl)phenyl]benzenecarboximidate |
| SMILES | CCC/C=C/CO/C(=N\c1ccc(C(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H20F3NO/c1-2-3-4-8-15-25-19(16-9-6-5-7-10-16)24-18-13-11-17(12-14-18)20(21,22)23/h4-14H,2-3,15H2,1H3/b8-4+,24-19- |
| InChIKey | WLZLIINDLVRUBW-FRYCZZRTSA-N |
| XLogP | 6.16 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-hex-2-enyl] N-[4-(trifluoromethyl)phenyl]benzenecarboximidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-hex-2-enyl] N-[4-(trifluoromethyl)phenyl]benzenecarboximidate?
The IUPAC name of [(E)-hex-2-enyl] N-[4-(trifluoromethyl)phenyl]benzenecarboximidate (CID 10760059) is [(E)-hex-2-enyl] N-[4-(trifluoromethyl)phenyl]benzenecarboximidate.
What is the SMILES notation for [(E)-hex-2-enyl] N-[4-(trifluoromethyl)phenyl]benzenecarboximidate?
The canonical SMILES for [(E)-hex-2-enyl] N-[4-(trifluoromethyl)phenyl]benzenecarboximidate is CCC/C=C/CO/C(=N\c1ccc(C(F)(F)F)cc1)c1ccccc1.
What is the InChIKey of [(E)-hex-2-enyl] N-[4-(trifluoromethyl)phenyl]benzenecarboximidate?
The InChIKey is WLZLIINDLVRUBW-FRYCZZRTSA-N. The full InChI is InChI=1S/C20H20F3NO/c1-2-3-4-8-15-25-19(16-9-6-5-7-10-16)24-18-13-11-17(12-14-18)20(21,22)23/h4-14H,2-3,15H2,1H3/b8-4+,24-19-.
What are the key properties of [(E)-hex-2-enyl] N-[4-(trifluoromethyl)phenyl]benzenecarboximidate?
[(E)-hex-2-enyl] N-[4-(trifluoromethyl)phenyl]benzenecarboximidate has a molecular weight of 347.38 g/mol, XLogP of 6.16, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-hex-2-enyl] N-[4-(trifluoromethyl)phenyl]benzenecarboximidate is sourced from PubChem (CID 10760059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).