C16H31BrOSi — CID 10760066
bromomethyl-dimethyl-(2,6,6-trimethyl-3-propan-2-ylhept-4-yn-3-yl)oxysilane (PubChem CID 10760066) has the molecular formula C16H31BrOSi and a molecular weight of 347.41 g/mol. Its IUPAC name is bromomethyl-dimethyl-(2,6,6-trimethyl-3-propan-2-ylhept-4-yn-3-yl)oxysilane.
| Compound Name | bromomethyl-dimethyl-(2,6,6-trimethyl-3-propan-2-ylhept-4-yn-3-yl)oxysilane |
|---|---|
| PubChem CID | 10760066 |
| Molecular Formula | C16H31BrOSi |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | bromomethyl-dimethyl-(2,6,6-trimethyl-3-propan-2-ylhept-4-yn-3-yl)oxysilane |
| SMILES | CC(C)C(C#CC(C)(C)C)(O[Si](C)(C)CBr)C(C)C |
| InChI | InChI=1S/C16H31BrOSi/c1-13(2)16(14(3)4,11-10-15(5,6)7)18-19(8,9)12-17/h13-14H,12H2,1-9H3 |
| InChIKey | KYUZGZGZWBOFQX-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|