C16H13Br2ClN2 — CID 107601522
2-(2-chloroethyl)-1-(2,6-dibromophenyl)-7-methylbenzimidazole (PubChem CID 107601522) has the molecular formula C16H13Br2ClN2 and a molecular weight of 428.56 g/mol. Its IUPAC name is 2-(2-chloroethyl)-1-(2,6-dibromophenyl)-7-methylbenzimidazole.
| Compound Name | 2-(2-chloroethyl)-1-(2,6-dibromophenyl)-7-methylbenzimidazole |
|---|---|
| PubChem CID | 107601522 |
| Molecular Formula | C16H13Br2ClN2 |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 425.91 |
| IUPAC Name | 2-(2-chloroethyl)-1-(2,6-dibromophenyl)-7-methylbenzimidazole |
| SMILES | Cc1cccc2nc(CCCl)n(-c3c(Br)cccc3Br)c12 |
| InChI | InChI=1S/C16H13Br2ClN2/c1-10-4-2-7-13-15(10)21(14(20-13)8-9-19)16-11(17)5-3-6-12(16)18/h2-7H,8-9H2,1H3 |
| InChIKey | KTKKEPFSKFDGIY-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|