C12H18N4O4S — CID 107602057
(2R)-2-[(4-methoxy-6-methylpyrimidin-2-yl)carbamoylamino]-4-methylsulfanylbutanoic acid (PubChem CID 107602057) has the molecular formula C12H18N4O4S and a molecular weight of 314.37 g/mol. Its IUPAC name is (2R)-2-[(4-methoxy-6-methylpyrimidin-2-yl)carbamoylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2R)-2-[(4-methoxy-6-methylpyrimidin-2-yl)carbamoylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 107602057 |
| Molecular Formula | C12H18N4O4S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | (2R)-2-[(4-methoxy-6-methylpyrimidin-2-yl)carbamoylamino]-4-methylsulfanylbutanoic acid |
| SMILES | COc1cc(C)nc(NC(=O)N[C@H](CCSC)C(=O)O)n1 |
| InChI | InChI=1S/C12H18N4O4S/c1-7-6-9(20-2)15-11(13-7)16-12(19)14-8(10(17)18)4-5-21-3/h6,8H,4-5H2,1-3H3,(H,17,18)(H2,13,14,15,16,19)/t8-/m1/s1 |
| InChIKey | DINQLAKHDYBBTA-MRVPVSSYSA-N |
| XLogP | 1.12 |
| TPSA | 113.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |