C22H35N — CID 10760278
3,3-dimethyl-1-[5-(1,2,3,4-tetrahydronaphthalen-1-yl)pentyl]piperidine (PubChem CID 10760278) has the molecular formula C22H35N and a molecular weight of 313.53 g/mol. Its IUPAC name is 3,3-dimethyl-1-[5-(1,2,3,4-tetrahydronaphthalen-1-yl)pentyl]piperidine.
| Compound Name | 3,3-dimethyl-1-[5-(1,2,3,4-tetrahydronaphthalen-1-yl)pentyl]piperidine |
|---|---|
| PubChem CID | 10760278 |
| Molecular Formula | C22H35N |
| Molecular Weight | 313.53 g/mol |
| Exact Mass | 313.28 |
| IUPAC Name | 3,3-dimethyl-1-[5-(1,2,3,4-tetrahydronaphthalen-1-yl)pentyl]piperidine |
| SMILES | CC1(C)CCCN(CCCCCC2CCCc3ccccc32)C1 |
| InChI | InChI=1S/C22H35N/c1-22(2)15-9-17-23(18-22)16-7-3-4-10-19-12-8-13-20-11-5-6-14-21(19)20/h5-6,11,14,19H,3-4,7-10,12-13,15-18H2,1-2H3 |
| InChIKey | OAEOGYNATHWNGE-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.53 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|