C19H18N4O3 — CID 10760308
8-[(E)-2-(3-methoxyphenyl)ethenyl]-3,7-dimethyl-1-prop-2-ynylpurine-2,6-dione (PubChem CID 10760308) has the molecular formula C19H18N4O3 and a molecular weight of 350.38 g/mol. Its IUPAC name is 8-[(E)-2-(3-methoxyphenyl)ethenyl]-3,7-dimethyl-1-prop-2-ynylpurine-2,6-dione.
| Compound Name | 8-[(E)-2-(3-methoxyphenyl)ethenyl]-3,7-dimethyl-1-prop-2-ynylpurine-2,6-dione |
|---|---|
| PubChem CID | 10760308 |
| Molecular Formula | C19H18N4O3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 8-[(E)-2-(3-methoxyphenyl)ethenyl]-3,7-dimethyl-1-prop-2-ynylpurine-2,6-dione |
| SMILES | C#CCn1c(=O)c2c(nc(/C=C/c3cccc(OC)c3)n2C)n(C)c1=O |
| InChI | InChI=1S/C19H18N4O3/c1-5-11-23-18(24)16-17(22(3)19(23)25)20-15(21(16)2)10-9-13-7-6-8-14(12-13)26-4/h1,6-10,12H,11H2,2-4H3/b10-9+ |
| InChIKey | VLFWFDXPDOEDFZ-MDZDMXLPSA-N |
| XLogP | 1.25 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|