C15H15Br2N3O — CID 107603232
N-(2,6-dibromophenyl)-2-ethyl-6-(methylamino)pyridine-4-carboxamide (PubChem CID 107603232) has the molecular formula C15H15Br2N3O and a molecular weight of 413.11 g/mol. Its IUPAC name is N-(2,6-dibromophenyl)-2-ethyl-6-(methylamino)pyridine-4-carboxamide.
| Compound Name | N-(2,6-dibromophenyl)-2-ethyl-6-(methylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 107603232 |
| Molecular Formula | C15H15Br2N3O |
| Molecular Weight | 413.11 g/mol |
| Exact Mass | 410.96 |
| IUPAC Name | N-(2,6-dibromophenyl)-2-ethyl-6-(methylamino)pyridine-4-carboxamide |
| SMILES | CCc1cc(C(=O)Nc2c(Br)cccc2Br)cc(NC)n1 |
| InChI | InChI=1S/C15H15Br2N3O/c1-3-10-7-9(8-13(18-2)19-10)15(21)20-14-11(16)5-4-6-12(14)17/h4-8H,3H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | JXZYSQYCEWPTEQ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.11 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |