C12H15BrFN5 — CID 107603622
N-[[1-(2-bromo-6-fluorophenyl)tetrazol-5-yl]methyl]-2-methylpropan-2-amine (PubChem CID 107603622) has the molecular formula C12H15BrFN5 and a molecular weight of 328.19 g/mol. Its IUPAC name is N-[[1-(2-bromo-6-fluorophenyl)tetrazol-5-yl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[1-(2-bromo-6-fluorophenyl)tetrazol-5-yl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 107603622 |
| Molecular Formula | C12H15BrFN5 |
| Molecular Weight | 328.19 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | N-[[1-(2-bromo-6-fluorophenyl)tetrazol-5-yl]methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCc1nnnn1-c1c(F)cccc1Br |
| InChI | InChI=1S/C12H15BrFN5/c1-12(2,3)15-7-10-16-17-18-19(10)11-8(13)5-4-6-9(11)14/h4-6,15H,7H2,1-3H3 |
| InChIKey | KFYCUJLMAONVRW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.19 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |