C16H24Br2N2 — CID 107603860
1-(2,6-dibromophenyl)-2-ethyl-5-(2-methylpropyl)piperazine (PubChem CID 107603860) has the molecular formula C16H24Br2N2 and a molecular weight of 404.19 g/mol. Its IUPAC name is 1-(2,6-dibromophenyl)-2-ethyl-5-(2-methylpropyl)piperazine.
| Compound Name | 1-(2,6-dibromophenyl)-2-ethyl-5-(2-methylpropyl)piperazine |
|---|---|
| PubChem CID | 107603860 |
| Molecular Formula | C16H24Br2N2 |
| Molecular Weight | 404.19 g/mol |
| Exact Mass | 402.03 |
| IUPAC Name | 1-(2,6-dibromophenyl)-2-ethyl-5-(2-methylpropyl)piperazine |
| SMILES | CCC1CNC(CC(C)C)CN1c1c(Br)cccc1Br |
| InChI | InChI=1S/C16H24Br2N2/c1-4-13-9-19-12(8-11(2)3)10-20(13)16-14(17)6-5-7-15(16)18/h5-7,11-13,19H,4,8-10H2,1-3H3 |
| InChIKey | GEYFTMSXYXPCIQ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.19 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |