C9H9Br2NOS — CID 107604205
N-(2,6-dibromophenyl)-3-sulfanylpropanamide (PubChem CID 107604205) has the molecular formula C9H9Br2NOS and a molecular weight of 339.05 g/mol. Its IUPAC name is N-(2,6-dibromophenyl)-3-sulfanylpropanamide.
| Compound Name | N-(2,6-dibromophenyl)-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 107604205 |
| Molecular Formula | C9H9Br2NOS |
| Molecular Weight | 339.05 g/mol |
| Exact Mass | 336.88 |
| IUPAC Name | N-(2,6-dibromophenyl)-3-sulfanylpropanamide |
| SMILES | O=C(CCS)Nc1c(Br)cccc1Br |
| InChI | InChI=1S/C9H9Br2NOS/c10-6-2-1-3-7(11)9(6)12-8(13)4-5-14/h1-3,14H,4-5H2,(H,12,13) |
| InChIKey | BVBJSBAFCGHAAP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.05 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|