C15H17Cl2F2NS — CID 10760430
2-[[(4aR,8aR)-8,8-dichloro-7,7-difluoro-2,3,4,5,6,8a-hexahydro-1H-naphthalen-4a-yl]sulfanyl]pyridine (PubChem CID 10760430) has the molecular formula C15H17Cl2F2NS and a molecular weight of 352.28 g/mol. Its IUPAC name is 2-[[(4aR,8aR)-8,8-dichloro-7,7-difluoro-2,3,4,5,6,8a-hexahydro-1H-naphthalen-4a-yl]sulfanyl]pyridine.
| Compound Name | 2-[[(4aR,8aR)-8,8-dichloro-7,7-difluoro-2,3,4,5,6,8a-hexahydro-1H-naphthalen-4a-yl]sulfanyl]pyridine |
|---|---|
| PubChem CID | 10760430 |
| Molecular Formula | C15H17Cl2F2NS |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 2-[[(4aR,8aR)-8,8-dichloro-7,7-difluoro-2,3,4,5,6,8a-hexahydro-1H-naphthalen-4a-yl]sulfanyl]pyridine |
| SMILES | FC1(F)CC[C@]2(Sc3ccccn3)CCCC[C@H]2C1(Cl)Cl |
| InChI | InChI=1S/C15H17Cl2F2NS/c16-15(17)11-5-1-3-7-13(11,8-9-14(15,18)19)21-12-6-2-4-10-20-12/h2,4,6,10-11H,1,3,5,7-9H2/t11-,13-/m1/s1 |
| InChIKey | KQGTVRYXLGGAOA-DGCLKSJQSA-N |
| XLogP | 5.71 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|