About 2-cyclopropyl-N-(2,6-dibromophenyl)-6-hydrazinyl-5-methylpyrimidin-4-amine
2-cyclopropyl-N-(2,6-dibromophenyl)-6-hydrazinyl-5-methylpyrimidin-4-amine (PubChem CID 107604844) has the molecular formula C14H15Br2N5
and a molecular weight of 413.12 g/mol. Its IUPAC name is 2-cyclopropyl-N-(2,6-dibromophenyl)-6-hydrazinyl-5-methylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-cyclopropyl-N-(2,6-dibromophenyl)-6-hydrazinyl-5-methylpyrimidin-4-amine |
| PubChem CID | 107604844 |
| Molecular Formula | C14H15Br2N5 |
| Molecular Weight | 413.12 g/mol |
| Exact Mass | 410.97 |
| IUPAC Name | 2-cyclopropyl-N-(2,6-dibromophenyl)-6-hydrazinyl-5-methylpyrimidin-4-amine |
| SMILES | Cc1c(NN)nc(C2CC2)nc1Nc1c(Br)cccc1Br |
| InChI | InChI=1S/C14H15Br2N5/c1-7-12(18-11-9(15)3-2-4-10(11)16)19-14(8-5-6-8)20-13(7)21-17/h2-4,8H,5-6,17H2,1H3,(H2,18,19,20,21) |
| InChIKey | XCSUPBUREPIERX-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.12 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopropyl-N-(2,6-dibromophenyl)-6-hydrazinyl-5-methylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-N-(2,6-dibromophenyl)-6-hydrazinyl-5-methylpyrimidin-4-amine?
The IUPAC name of 2-cyclopropyl-N-(2,6-dibromophenyl)-6-hydrazinyl-5-methylpyrimidin-4-amine (CID 107604844) is 2-cyclopropyl-N-(2,6-dibromophenyl)-6-hydrazinyl-5-methylpyrimidin-4-amine.
What is the SMILES notation for 2-cyclopropyl-N-(2,6-dibromophenyl)-6-hydrazinyl-5-methylpyrimidin-4-amine?
The canonical SMILES for 2-cyclopropyl-N-(2,6-dibromophenyl)-6-hydrazinyl-5-methylpyrimidin-4-amine is Cc1c(NN)nc(C2CC2)nc1Nc1c(Br)cccc1Br.
What is the InChIKey of 2-cyclopropyl-N-(2,6-dibromophenyl)-6-hydrazinyl-5-methylpyrimidin-4-amine?
The InChIKey is XCSUPBUREPIERX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15Br2N5/c1-7-12(18-11-9(15)3-2-4-10(11)16)19-14(8-5-6-8)20-13(7)21-17/h2-4,8H,5-6,17H2,1H3,(H2,18,19,20,21).
What are the key properties of 2-cyclopropyl-N-(2,6-dibromophenyl)-6-hydrazinyl-5-methylpyrimidin-4-amine?
2-cyclopropyl-N-(2,6-dibromophenyl)-6-hydrazinyl-5-methylpyrimidin-4-amine has a molecular weight of 413.12 g/mol, XLogP of 4.22, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-N-(2,6-dibromophenyl)-6-hydrazinyl-5-methylpyrimidin-4-amine is sourced from PubChem (CID 107604844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).