About 2-(2,2-dimethylpropanoylamino)-N-(1-methylbenzimidazol-2-yl)benzamide
2-(2,2-dimethylpropanoylamino)-N-(1-methylbenzimidazol-2-yl)benzamide (PubChem CID 1076051) has the molecular formula C20H22N4O2
and a molecular weight of 350.42 g/mol. Its IUPAC name is 2-(2,2-dimethylpropanoylamino)-N-(1-methylbenzimidazol-2-yl)benzamide.
Molecular Properties
| Compound Name | 2-(2,2-dimethylpropanoylamino)-N-(1-methylbenzimidazol-2-yl)benzamide |
| PubChem CID | 1076051 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 2-(2,2-dimethylpropanoylamino)-N-(1-methylbenzimidazol-2-yl)benzamide |
| SMILES | Cn1c(NC(=O)c2ccccc2NC(=O)C(C)(C)C)nc2ccccc21 |
| InChI | InChI=1S/C20H22N4O2/c1-20(2,3)18(26)21-14-10-6-5-9-13(14)17(25)23-19-22-15-11-7-8-12-16(15)24(19)4/h5-12H,1-4H3,(H,21,26)(H,22,23,25) |
| InChIKey | FXOKVFWLVUMPRO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2,2-dimethylpropanoylamino)-N-(1-methylbenzimidazol-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-dimethylpropanoylamino)-N-(1-methylbenzimidazol-2-yl)benzamide?
The IUPAC name of 2-(2,2-dimethylpropanoylamino)-N-(1-methylbenzimidazol-2-yl)benzamide (CID 1076051) is 2-(2,2-dimethylpropanoylamino)-N-(1-methylbenzimidazol-2-yl)benzamide.
What is the SMILES notation for 2-(2,2-dimethylpropanoylamino)-N-(1-methylbenzimidazol-2-yl)benzamide?
The canonical SMILES for 2-(2,2-dimethylpropanoylamino)-N-(1-methylbenzimidazol-2-yl)benzamide is Cn1c(NC(=O)c2ccccc2NC(=O)C(C)(C)C)nc2ccccc21.
What is the InChIKey of 2-(2,2-dimethylpropanoylamino)-N-(1-methylbenzimidazol-2-yl)benzamide?
The InChIKey is FXOKVFWLVUMPRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N4O2/c1-20(2,3)18(26)21-14-10-6-5-9-13(14)17(25)23-19-22-15-11-7-8-12-16(15)24(19)4/h5-12H,1-4H3,(H,21,26)(H,22,23,25).
What are the key properties of 2-(2,2-dimethylpropanoylamino)-N-(1-methylbenzimidazol-2-yl)benzamide?
2-(2,2-dimethylpropanoylamino)-N-(1-methylbenzimidazol-2-yl)benzamide has a molecular weight of 350.42 g/mol, XLogP of 3.81, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethylpropanoylamino)-N-(1-methylbenzimidazol-2-yl)benzamide is sourced from PubChem (CID 1076051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).