C12H13ClN4O3S — CID 107605455
2-amino-4-chloro-N-(4-methoxy-6-methylpyrimidin-2-yl)benzenesulfonamide (PubChem CID 107605455) has the molecular formula C12H13ClN4O3S and a molecular weight of 328.78 g/mol. Its IUPAC name is 2-amino-4-chloro-N-(4-methoxy-6-methylpyrimidin-2-yl)benzenesulfonamide.
| Compound Name | 2-amino-4-chloro-N-(4-methoxy-6-methylpyrimidin-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 107605455 |
| Molecular Formula | C12H13ClN4O3S |
| Molecular Weight | 328.78 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 2-amino-4-chloro-N-(4-methoxy-6-methylpyrimidin-2-yl)benzenesulfonamide |
| SMILES | COc1cc(C)nc(NS(=O)(=O)c2ccc(Cl)cc2N)n1 |
| InChI | InChI=1S/C12H13ClN4O3S/c1-7-5-11(20-2)16-12(15-7)17-21(18,19)10-4-3-8(13)6-9(10)14/h3-6H,14H2,1-2H3,(H,15,16,17) |
| InChIKey | ZVKNADTZFASSAC-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.78 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|