C10H10ClIN4O2S — CID 107605475
5-amino-N-(2-chloro-4-iodophenyl)-3-methylimidazole-4-sulfonamide (PubChem CID 107605475) has the molecular formula C10H10ClIN4O2S and a molecular weight of 412.64 g/mol. Its IUPAC name is 5-amino-N-(2-chloro-4-iodophenyl)-3-methylimidazole-4-sulfonamide.
| Compound Name | 5-amino-N-(2-chloro-4-iodophenyl)-3-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 107605475 |
| Molecular Formula | C10H10ClIN4O2S |
| Molecular Weight | 412.64 g/mol |
| Exact Mass | 411.93 |
| IUPAC Name | 5-amino-N-(2-chloro-4-iodophenyl)-3-methylimidazole-4-sulfonamide |
| SMILES | Cn1cnc(N)c1S(=O)(=O)Nc1ccc(I)cc1Cl |
| InChI | InChI=1S/C10H10ClIN4O2S/c1-16-5-14-9(13)10(16)19(17,18)15-8-3-2-6(12)4-7(8)11/h2-5,15H,13H2,1H3 |
| InChIKey | AWQJPNOEKKINBW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.64 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|