C15H16ClIN2 — CID 107605988
1-(2-chloro-4-iodophenyl)-2-methyl-4,5,6,7-tetrahydroindol-4-amine (PubChem CID 107605988) has the molecular formula C15H16ClIN2 and a molecular weight of 386.66 g/mol. Its IUPAC name is 1-(2-chloro-4-iodophenyl)-2-methyl-4,5,6,7-tetrahydroindol-4-amine.
| Compound Name | 1-(2-chloro-4-iodophenyl)-2-methyl-4,5,6,7-tetrahydroindol-4-amine |
|---|---|
| PubChem CID | 107605988 |
| Molecular Formula | C15H16ClIN2 |
| Molecular Weight | 386.66 g/mol |
| Exact Mass | 386.00 |
| IUPAC Name | 1-(2-chloro-4-iodophenyl)-2-methyl-4,5,6,7-tetrahydroindol-4-amine |
| SMILES | Cc1cc2c(n1-c1ccc(I)cc1Cl)CCCC2N |
| InChI | InChI=1S/C15H16ClIN2/c1-9-7-11-13(18)3-2-4-14(11)19(9)15-6-5-10(17)8-12(15)16/h5-8,13H,2-4,18H2,1H3 |
| InChIKey | GJZPICWXXJONQD-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.66 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|