C13H10Cl2IN3O — CID 107606074
5-chloro-N-(2-chloro-4-iodophenyl)-6-(methylamino)pyridine-3-carboxamide (PubChem CID 107606074) has the molecular formula C13H10Cl2IN3O and a molecular weight of 422.05 g/mol. Its IUPAC name is 5-chloro-N-(2-chloro-4-iodophenyl)-6-(methylamino)pyridine-3-carboxamide.
| Compound Name | 5-chloro-N-(2-chloro-4-iodophenyl)-6-(methylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 107606074 |
| Molecular Formula | C13H10Cl2IN3O |
| Molecular Weight | 422.05 g/mol |
| Exact Mass | 420.92 |
| IUPAC Name | 5-chloro-N-(2-chloro-4-iodophenyl)-6-(methylamino)pyridine-3-carboxamide |
| SMILES | CNc1ncc(C(=O)Nc2ccc(I)cc2Cl)cc1Cl |
| InChI | InChI=1S/C13H10Cl2IN3O/c1-17-12-10(15)4-7(6-18-12)13(20)19-11-3-2-8(16)5-9(11)14/h2-6H,1H3,(H,17,18)(H,19,20) |
| InChIKey | QRZDXOVIMFIBPL-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.05 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|