C12H17ClINO — CID 107606330
1-(2-chloro-4-iodoanilino)-2,3-dimethylbutan-2-ol (PubChem CID 107606330) has the molecular formula C12H17ClINO and a molecular weight of 353.63 g/mol. Its IUPAC name is 1-(2-chloro-4-iodoanilino)-2,3-dimethylbutan-2-ol.
| Compound Name | 1-(2-chloro-4-iodoanilino)-2,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 107606330 |
| Molecular Formula | C12H17ClINO |
| Molecular Weight | 353.63 g/mol |
| Exact Mass | 353.00 |
| IUPAC Name | 1-(2-chloro-4-iodoanilino)-2,3-dimethylbutan-2-ol |
| SMILES | CC(C)C(C)(O)CNc1ccc(I)cc1Cl |
| InChI | InChI=1S/C12H17ClINO/c1-8(2)12(3,16)7-15-11-5-4-9(14)6-10(11)13/h4-6,8,15-16H,7H2,1-3H3 |
| InChIKey | RGZAACKQPVJYAE-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.63 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|