C10H6ClIN2O3 — CID 107607038
2-(2-chloro-4-iodoanilino)-1,3-oxazole-4-carboxylic acid (PubChem CID 107607038) has the molecular formula C10H6ClIN2O3 and a molecular weight of 364.53 g/mol. Its IUPAC name is 2-(2-chloro-4-iodoanilino)-1,3-oxazole-4-carboxylic acid.
| Compound Name | 2-(2-chloro-4-iodoanilino)-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 107607038 |
| Molecular Formula | C10H6ClIN2O3 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 363.91 |
| IUPAC Name | 2-(2-chloro-4-iodoanilino)-1,3-oxazole-4-carboxylic acid |
| SMILES | O=C(O)c1coc(Nc2ccc(I)cc2Cl)n1 |
| InChI | InChI=1S/C10H6ClIN2O3/c11-6-3-5(12)1-2-7(6)13-10-14-8(4-17-10)9(15)16/h1-4H,(H,13,14)(H,15,16) |
| InChIKey | UDGVLGKUAZVVFO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|