C14H17ClINO3 — CID 107607106
4-[(2-chloro-4-iodoanilino)methyl]-4-hydroxycyclohexane-1-carboxylic acid (PubChem CID 107607106) has the molecular formula C14H17ClINO3 and a molecular weight of 409.65 g/mol. Its IUPAC name is 4-[(2-chloro-4-iodoanilino)methyl]-4-hydroxycyclohexane-1-carboxylic acid.
| Compound Name | 4-[(2-chloro-4-iodoanilino)methyl]-4-hydroxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 107607106 |
| Molecular Formula | C14H17ClINO3 |
| Molecular Weight | 409.65 g/mol |
| Exact Mass | 408.99 |
| IUPAC Name | 4-[(2-chloro-4-iodoanilino)methyl]-4-hydroxycyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(O)(CNc2ccc(I)cc2Cl)CC1 |
| InChI | InChI=1S/C14H17ClINO3/c15-11-7-10(16)1-2-12(11)17-8-14(20)5-3-9(4-6-14)13(18)19/h1-2,7,9,17,20H,3-6,8H2,(H,18,19) |
| InChIKey | JICWUIUGSHPFQD-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.65 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|