C13H13ClIN3O2S — CID 107607153
2-[[4-(2-chloro-4-iodophenyl)-5-propan-2-yl-1,2,4-triazol-3-yl]sulfanyl]acetic acid (PubChem CID 107607153) has the molecular formula C13H13ClIN3O2S and a molecular weight of 437.69 g/mol. Its IUPAC name is 2-[[4-(2-chloro-4-iodophenyl)-5-propan-2-yl-1,2,4-triazol-3-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[4-(2-chloro-4-iodophenyl)-5-propan-2-yl-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 107607153 |
| Molecular Formula | C13H13ClIN3O2S |
| Molecular Weight | 437.69 g/mol |
| Exact Mass | 436.95 |
| IUPAC Name | 2-[[4-(2-chloro-4-iodophenyl)-5-propan-2-yl-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
| SMILES | CC(C)c1nnc(SCC(=O)O)n1-c1ccc(I)cc1Cl |
| InChI | InChI=1S/C13H13ClIN3O2S/c1-7(2)12-16-17-13(21-6-11(19)20)18(12)10-4-3-8(15)5-9(10)14/h3-5,7H,6H2,1-2H3,(H,19,20) |
| InChIKey | AWGIXYLZWQYNDH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.69 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|