C13H17BrN4O3 — CID 10760763
(2R)-2-[(4-bromo-1H-pyrrole-2-carbonyl)amino]-3-[(4S)-3,4-dimethyl-1,5-dihydroimidazol-3-ium-4-yl]propanoate (PubChem CID 10760763) has the molecular formula C13H17BrN4O3 and a molecular weight of 357.21 g/mol. Its IUPAC name is (2R)-2-[(4-bromo-1H-pyrrole-2-carbonyl)amino]-3-[(4S)-3,4-dimethyl-1,5-dihydroimidazol-3-ium-4-yl]propanoate.
| Compound Name | (2R)-2-[(4-bromo-1H-pyrrole-2-carbonyl)amino]-3-[(4S)-3,4-dimethyl-1,5-dihydroimidazol-3-ium-4-yl]propanoate |
|---|---|
| PubChem CID | 10760763 |
| Molecular Formula | C13H17BrN4O3 |
| Molecular Weight | 357.21 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | (2R)-2-[(4-bromo-1H-pyrrole-2-carbonyl)amino]-3-[(4S)-3,4-dimethyl-1,5-dihydroimidazol-3-ium-4-yl]propanoate |
| SMILES | C[N+]1=CNC[C@]1(C)C[C@@H](NC(=O)c1cc(Br)c[nH]1)C(=O)[O-] |
| InChI | InChI=1S/C13H17BrN4O3/c1-13(6-15-7-18(13)2)4-10(12(20)21)17-11(19)9-3-8(14)5-16-9/h3,5,7,10H,4,6H2,1-2H3,(H3,16,17,19,20,21)/t10-,13+/m1/s1 |
| InChIKey | SUQOMBNELBOXBZ-MFKMUULPSA-N |
| XLogP | -0.95 |
| TPSA | 100.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.21 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|