About 1-(4-bromo-2,5-difluorophenyl)-3-(propan-2-ylamino)pyrrolidin-2-one
1-(4-bromo-2,5-difluorophenyl)-3-(propan-2-ylamino)pyrrolidin-2-one (PubChem CID 107608068) has the molecular formula C13H15BrF2N2O
and a molecular weight of 333.18 g/mol. Its IUPAC name is 1-(4-bromo-2,5-difluorophenyl)-3-(propan-2-ylamino)pyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-(4-bromo-2,5-difluorophenyl)-3-(propan-2-ylamino)pyrrolidin-2-one |
| PubChem CID | 107608068 |
| Molecular Formula | C13H15BrF2N2O |
| Molecular Weight | 333.18 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | 1-(4-bromo-2,5-difluorophenyl)-3-(propan-2-ylamino)pyrrolidin-2-one |
| SMILES | CC(C)NC1CCN(c2cc(F)c(Br)cc2F)C1=O |
| InChI | InChI=1S/C13H15BrF2N2O/c1-7(2)17-11-3-4-18(13(11)19)12-6-9(15)8(14)5-10(12)16/h5-7,11,17H,3-4H2,1-2H3 |
| InChIKey | PYFLWWZUADIBDV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.18 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-bromo-2,5-difluorophenyl)-3-(propan-2-ylamino)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromo-2,5-difluorophenyl)-3-(propan-2-ylamino)pyrrolidin-2-one?
The IUPAC name of 1-(4-bromo-2,5-difluorophenyl)-3-(propan-2-ylamino)pyrrolidin-2-one (CID 107608068) is 1-(4-bromo-2,5-difluorophenyl)-3-(propan-2-ylamino)pyrrolidin-2-one.
What is the SMILES notation for 1-(4-bromo-2,5-difluorophenyl)-3-(propan-2-ylamino)pyrrolidin-2-one?
The canonical SMILES for 1-(4-bromo-2,5-difluorophenyl)-3-(propan-2-ylamino)pyrrolidin-2-one is CC(C)NC1CCN(c2cc(F)c(Br)cc2F)C1=O.
What is the InChIKey of 1-(4-bromo-2,5-difluorophenyl)-3-(propan-2-ylamino)pyrrolidin-2-one?
The InChIKey is PYFLWWZUADIBDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15BrF2N2O/c1-7(2)17-11-3-4-18(13(11)19)12-6-9(15)8(14)5-10(12)16/h5-7,11,17H,3-4H2,1-2H3.
What are the key properties of 1-(4-bromo-2,5-difluorophenyl)-3-(propan-2-ylamino)pyrrolidin-2-one?
1-(4-bromo-2,5-difluorophenyl)-3-(propan-2-ylamino)pyrrolidin-2-one has a molecular weight of 333.18 g/mol, XLogP of 2.83, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromo-2,5-difluorophenyl)-3-(propan-2-ylamino)pyrrolidin-2-one is sourced from PubChem (CID 107608068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).