C11H6BrF2N3S — CID 107608269
5-(4-bromo-2,5-difluoroanilino)-3-methyl-1,2-thiazole-4-carbonitrile (PubChem CID 107608269) has the molecular formula C11H6BrF2N3S and a molecular weight of 330.16 g/mol. Its IUPAC name is 5-(4-bromo-2,5-difluoroanilino)-3-methyl-1,2-thiazole-4-carbonitrile.
| Compound Name | 5-(4-bromo-2,5-difluoroanilino)-3-methyl-1,2-thiazole-4-carbonitrile |
|---|---|
| PubChem CID | 107608269 |
| Molecular Formula | C11H6BrF2N3S |
| Molecular Weight | 330.16 g/mol |
| Exact Mass | 328.94 |
| IUPAC Name | 5-(4-bromo-2,5-difluoroanilino)-3-methyl-1,2-thiazole-4-carbonitrile |
| SMILES | Cc1nsc(Nc2cc(F)c(Br)cc2F)c1C#N |
| InChI | InChI=1S/C11H6BrF2N3S/c1-5-6(4-15)11(18-17-5)16-10-3-8(13)7(12)2-9(10)14/h2-3,16H,1H3 |
| InChIKey | IUMRRDDNLHYCKE-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.16 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|