About [3-(4-bromo-2,5-difluorophenyl)imidazol-4-yl]-(oxolan-3-yl)methanamine
[3-(4-bromo-2,5-difluorophenyl)imidazol-4-yl]-(oxolan-3-yl)methanamine (PubChem CID 107608570) has the molecular formula C14H14BrF2N3O
and a molecular weight of 358.19 g/mol. Its IUPAC name is [3-(4-bromo-2,5-difluorophenyl)imidazol-4-yl]-(oxolan-3-yl)methanamine.
Molecular Properties
| Compound Name | [3-(4-bromo-2,5-difluorophenyl)imidazol-4-yl]-(oxolan-3-yl)methanamine |
| PubChem CID | 107608570 |
| Molecular Formula | C14H14BrF2N3O |
| Molecular Weight | 358.19 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | [3-(4-bromo-2,5-difluorophenyl)imidazol-4-yl]-(oxolan-3-yl)methanamine |
| SMILES | NC(c1cncn1-c1cc(F)c(Br)cc1F)C1CCOC1 |
| InChI | InChI=1S/C14H14BrF2N3O/c15-9-3-11(17)12(4-10(9)16)20-7-19-5-13(20)14(18)8-1-2-21-6-8/h3-5,7-8,14H,1-2,6,18H2 |
| InChIKey | VKCRNUTXVADUNP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.19 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze [3-(4-bromo-2,5-difluorophenyl)imidazol-4-yl]-(oxolan-3-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-bromo-2,5-difluorophenyl)imidazol-4-yl]-(oxolan-3-yl)methanamine?
The IUPAC name of [3-(4-bromo-2,5-difluorophenyl)imidazol-4-yl]-(oxolan-3-yl)methanamine (CID 107608570) is [3-(4-bromo-2,5-difluorophenyl)imidazol-4-yl]-(oxolan-3-yl)methanamine.
What is the SMILES notation for [3-(4-bromo-2,5-difluorophenyl)imidazol-4-yl]-(oxolan-3-yl)methanamine?
The canonical SMILES for [3-(4-bromo-2,5-difluorophenyl)imidazol-4-yl]-(oxolan-3-yl)methanamine is NC(c1cncn1-c1cc(F)c(Br)cc1F)C1CCOC1.
What is the InChIKey of [3-(4-bromo-2,5-difluorophenyl)imidazol-4-yl]-(oxolan-3-yl)methanamine?
The InChIKey is VKCRNUTXVADUNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14BrF2N3O/c15-9-3-11(17)12(4-10(9)16)20-7-19-5-13(20)14(18)8-1-2-21-6-8/h3-5,7-8,14H,1-2,6,18H2.
What are the key properties of [3-(4-bromo-2,5-difluorophenyl)imidazol-4-yl]-(oxolan-3-yl)methanamine?
[3-(4-bromo-2,5-difluorophenyl)imidazol-4-yl]-(oxolan-3-yl)methanamine has a molecular weight of 358.19 g/mol, XLogP of 2.95, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-bromo-2,5-difluorophenyl)imidazol-4-yl]-(oxolan-3-yl)methanamine is sourced from PubChem (CID 107608570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).