C14H9BrF2N4 — CID 107608575
5-[3-(4-bromo-2,5-difluorophenyl)imidazol-4-yl]pyridin-2-amine (PubChem CID 107608575) has the molecular formula C14H9BrF2N4 and a molecular weight of 351.15 g/mol. Its IUPAC name is 5-[3-(4-bromo-2,5-difluorophenyl)imidazol-4-yl]pyridin-2-amine.
| Compound Name | 5-[3-(4-bromo-2,5-difluorophenyl)imidazol-4-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 107608575 |
| Molecular Formula | C14H9BrF2N4 |
| Molecular Weight | 351.15 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | 5-[3-(4-bromo-2,5-difluorophenyl)imidazol-4-yl]pyridin-2-amine |
| SMILES | Nc1ccc(-c2cncn2-c2cc(F)c(Br)cc2F)cn1 |
| InChI | InChI=1S/C14H9BrF2N4/c15-9-3-11(17)12(4-10(9)16)21-7-19-6-13(21)8-1-2-14(18)20-5-8/h1-7H,(H2,18,20) |
| InChIKey | KVYOGMQGPMYSQX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.15 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|