C19H21NO6 — CID 10760913
(2R,4S,8R,10S)-11-acetyl-6,6-dimethyl-5,7,16,18-tetraoxa-11-azapentacyclo[11.7.0.02,10.04,8.015,19]icosa-1(20),13,15(19)-trien-12-one (PubChem CID 10760913) has the molecular formula C19H21NO6 and a molecular weight of 359.38 g/mol. Its IUPAC name is (2R,4S,8R,10S)-11-acetyl-6,6-dimethyl-5,7,16,18-tetraoxa-11-azapentacyclo[11.7.0.02,10.04,8.015,19]icosa-1(20),13,15(19)-trien-12-one.
| Compound Name | (2R,4S,8R,10S)-11-acetyl-6,6-dimethyl-5,7,16,18-tetraoxa-11-azapentacyclo[11.7.0.02,10.04,8.015,19]icosa-1(20),13,15(19)-trien-12-one |
|---|---|
| PubChem CID | 10760913 |
| Molecular Formula | C19H21NO6 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | (2R,4S,8R,10S)-11-acetyl-6,6-dimethyl-5,7,16,18-tetraoxa-11-azapentacyclo[11.7.0.02,10.04,8.015,19]icosa-1(20),13,15(19)-trien-12-one |
| SMILES | CC(=O)N1C(=O)c2cc3c(cc2[C@H]2C[C@@H]4OC(C)(C)O[C@@H]4C[C@@H]21)OCO3 |
| InChI | InChI=1S/C19H21NO6/c1-9(21)20-13-7-17-16(25-19(2,3)26-17)5-11(13)10-4-14-15(24-8-23-14)6-12(10)18(20)22/h4,6,11,13,16-17H,5,7-8H2,1-3H3/t11-,13+,16+,17-/m1/s1 |
| InChIKey | BCSBHBZBYJIPQG-NYUZSIGZSA-N |
| XLogP | 2.18 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |