C13H17BrF2N2 — CID 107609339
4-bromo-2,5-difluoro-N-[(1-methylpiperidin-3-yl)methyl]aniline (PubChem CID 107609339) has the molecular formula C13H17BrF2N2 and a molecular weight of 319.19 g/mol. Its IUPAC name is 4-bromo-2,5-difluoro-N-[(1-methylpiperidin-3-yl)methyl]aniline.
| Compound Name | 4-bromo-2,5-difluoro-N-[(1-methylpiperidin-3-yl)methyl]aniline |
|---|---|
| PubChem CID | 107609339 |
| Molecular Formula | C13H17BrF2N2 |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 4-bromo-2,5-difluoro-N-[(1-methylpiperidin-3-yl)methyl]aniline |
| SMILES | CN1CCCC(CNc2cc(F)c(Br)cc2F)C1 |
| InChI | InChI=1S/C13H17BrF2N2/c1-18-4-2-3-9(8-18)7-17-13-6-11(15)10(14)5-12(13)16/h5-6,9,17H,2-4,7-8H2,1H3 |
| InChIKey | ATCQQIRDQKXFRH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|