C16H27NO8 — CID 10761055
[(2R,3S,5S)-3-acetyloxy-6-methoxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]oxan-2-yl]methyl acetate (PubChem CID 10761055) has the molecular formula C16H27NO8 and a molecular weight of 361.39 g/mol. Its IUPAC name is [(2R,3S,5S)-3-acetyloxy-6-methoxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,5S)-3-acetyloxy-6-methoxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10761055 |
| Molecular Formula | C16H27NO8 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | [(2R,3S,5S)-3-acetyloxy-6-methoxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]oxan-2-yl]methyl acetate |
| SMILES | COC1O[C@H](COC(C)=O)[C@@H](OC(C)=O)C[C@@H]1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H27NO8/c1-9(18)22-8-13-12(23-10(2)19)7-11(14(21-6)24-13)17-15(20)25-16(3,4)5/h11-14H,7-8H2,1-6H3,(H,17,20)/t11-,12-,13+,14?/m0/s1 |
| InChIKey | PMWWKIFYOCRDAG-ICIURTGMSA-N |
| XLogP | 1.14 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|