C16H26O9 — CID 10761118
ethyl (2S,6R)-6-[(1R)-1,2-diacetyloxyethyl]-4,4-dimethoxyoxane-2-carboxylate (PubChem CID 10761118) has the molecular formula C16H26O9 and a molecular weight of 362.38 g/mol. Its IUPAC name is ethyl (2S,6R)-6-[(1R)-1,2-diacetyloxyethyl]-4,4-dimethoxyoxane-2-carboxylate.
| Compound Name | ethyl (2S,6R)-6-[(1R)-1,2-diacetyloxyethyl]-4,4-dimethoxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 10761118 |
| Molecular Formula | C16H26O9 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | ethyl (2S,6R)-6-[(1R)-1,2-diacetyloxyethyl]-4,4-dimethoxyoxane-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CC(OC)(OC)C[C@H]([C@@H](COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C16H26O9/c1-6-22-15(19)13-8-16(20-4,21-5)7-12(25-13)14(24-11(3)18)9-23-10(2)17/h12-14H,6-9H2,1-5H3/t12-,13+,14-/m1/s1 |
| InChIKey | OLWAMGNUYDXXEM-HZSPNIEDSA-N |
| XLogP | 0.58 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|