About 1-(4-bromo-2,5-difluorophenyl)tetrazole
1-(4-bromo-2,5-difluorophenyl)tetrazole (PubChem CID 107613000) has the molecular formula C7H3BrF2N4
and a molecular weight of 261.03 g/mol. Its IUPAC name is 1-(4-bromo-2,5-difluorophenyl)tetrazole.
Molecular Properties
| Compound Name | 1-(4-bromo-2,5-difluorophenyl)tetrazole |
| PubChem CID | 107613000 |
| Molecular Formula | C7H3BrF2N4 |
| Molecular Weight | 261.03 g/mol |
| Exact Mass | 259.95 |
| IUPAC Name | 1-(4-bromo-2,5-difluorophenyl)tetrazole |
| SMILES | Fc1cc(-n2cnnn2)c(F)cc1Br |
| InChI | InChI=1S/C7H3BrF2N4/c8-4-1-6(10)7(2-5(4)9)14-3-11-12-13-14/h1-3H |
| InChIKey | RJVJCSXBCMUKPF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.03 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-bromo-2,5-difluorophenyl)tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromo-2,5-difluorophenyl)tetrazole?
The IUPAC name of 1-(4-bromo-2,5-difluorophenyl)tetrazole (CID 107613000) is 1-(4-bromo-2,5-difluorophenyl)tetrazole.
What is the SMILES notation for 1-(4-bromo-2,5-difluorophenyl)tetrazole?
The canonical SMILES for 1-(4-bromo-2,5-difluorophenyl)tetrazole is Fc1cc(-n2cnnn2)c(F)cc1Br.
What is the InChIKey of 1-(4-bromo-2,5-difluorophenyl)tetrazole?
The InChIKey is RJVJCSXBCMUKPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3BrF2N4/c8-4-1-6(10)7(2-5(4)9)14-3-11-12-13-14/h1-3H.
What are the key properties of 1-(4-bromo-2,5-difluorophenyl)tetrazole?
1-(4-bromo-2,5-difluorophenyl)tetrazole has a molecular weight of 261.03 g/mol, XLogP of 1.70, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromo-2,5-difluorophenyl)tetrazole is sourced from PubChem (CID 107613000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).