C11H13BrF2N2 — CID 107613029
1-(4-bromo-2,5-difluorophenyl)piperidin-4-amine (PubChem CID 107613029) has the molecular formula C11H13BrF2N2 and a molecular weight of 291.14 g/mol. Its IUPAC name is 1-(4-bromo-2,5-difluorophenyl)piperidin-4-amine.
| Compound Name | 1-(4-bromo-2,5-difluorophenyl)piperidin-4-amine |
|---|---|
| PubChem CID | 107613029 |
| Molecular Formula | C11H13BrF2N2 |
| Molecular Weight | 291.14 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 1-(4-bromo-2,5-difluorophenyl)piperidin-4-amine |
| SMILES | NC1CCN(c2cc(F)c(Br)cc2F)CC1 |
| InChI | InChI=1S/C11H13BrF2N2/c12-8-5-10(14)11(6-9(8)13)16-3-1-7(15)2-4-16/h5-7H,1-4,15H2 |
| InChIKey | UFDPBNSNZKNWBO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.14 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|