C12H10BrF2N3O2S — CID 107613758
2-[[4-(4-bromo-2,5-difluorophenyl)-5-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetic acid (PubChem CID 107613758) has the molecular formula C12H10BrF2N3O2S and a molecular weight of 378.20 g/mol. Its IUPAC name is 2-[[4-(4-bromo-2,5-difluorophenyl)-5-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[4-(4-bromo-2,5-difluorophenyl)-5-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 107613758 |
| Molecular Formula | C12H10BrF2N3O2S |
| Molecular Weight | 378.20 g/mol |
| Exact Mass | 376.96 |
| IUPAC Name | 2-[[4-(4-bromo-2,5-difluorophenyl)-5-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
| SMILES | CCc1nnc(SCC(=O)O)n1-c1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C12H10BrF2N3O2S/c1-2-10-16-17-12(21-5-11(19)20)18(10)9-4-7(14)6(13)3-8(9)15/h3-4H,2,5H2,1H3,(H,19,20) |
| InChIKey | QZHNHWXZQIADJH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.20 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|