About 2-[3,5-bis(2-trimethylsilylethynyl)phenyl]ethynyl-trimethylsilane
2-[3,5-bis(2-trimethylsilylethynyl)phenyl]ethynyl-trimethylsilane (PubChem CID 10761444) has the molecular formula C21H30Si3
and a molecular weight of 366.73 g/mol. Its IUPAC name is 2-[3,5-bis(2-trimethylsilylethynyl)phenyl]ethynyl-trimethylsilane.
Molecular Properties
| Compound Name | 2-[3,5-bis(2-trimethylsilylethynyl)phenyl]ethynyl-trimethylsilane |
| PubChem CID | 10761444 |
| Molecular Formula | C21H30Si3 |
| Molecular Weight | 366.73 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 2-[3,5-bis(2-trimethylsilylethynyl)phenyl]ethynyl-trimethylsilane |
| SMILES | C[Si](C)(C)C#Cc1cc(C#C[Si](C)(C)C)cc(C#C[Si](C)(C)C)c1 |
| InChI | InChI=1S/C21H30Si3/c1-22(2,3)13-10-19-16-20(11-14-23(4,5)6)18-21(17-19)12-15-24(7,8)9/h16-18H,1-9H3 |
| InChIKey | VVTLQYQLVFNQBM-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.73 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[3,5-bis(2-trimethylsilylethynyl)phenyl]ethynyl-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-bis(2-trimethylsilylethynyl)phenyl]ethynyl-trimethylsilane?
The IUPAC name of 2-[3,5-bis(2-trimethylsilylethynyl)phenyl]ethynyl-trimethylsilane (CID 10761444) is 2-[3,5-bis(2-trimethylsilylethynyl)phenyl]ethynyl-trimethylsilane.
What is the SMILES notation for 2-[3,5-bis(2-trimethylsilylethynyl)phenyl]ethynyl-trimethylsilane?
The canonical SMILES for 2-[3,5-bis(2-trimethylsilylethynyl)phenyl]ethynyl-trimethylsilane is C[Si](C)(C)C#Cc1cc(C#C[Si](C)(C)C)cc(C#C[Si](C)(C)C)c1.
What is the InChIKey of 2-[3,5-bis(2-trimethylsilylethynyl)phenyl]ethynyl-trimethylsilane?
The InChIKey is VVTLQYQLVFNQBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H30Si3/c1-22(2,3)13-10-19-16-20(11-14-23(4,5)6)18-21(17-19)12-15-24(7,8)9/h16-18H,1-9H3.
What are the key properties of 2-[3,5-bis(2-trimethylsilylethynyl)phenyl]ethynyl-trimethylsilane?
2-[3,5-bis(2-trimethylsilylethynyl)phenyl]ethynyl-trimethylsilane has a molecular weight of 366.73 g/mol, XLogP of 5.37, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-bis(2-trimethylsilylethynyl)phenyl]ethynyl-trimethylsilane is sourced from PubChem (CID 10761444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).