C19H17N3O3S — CID 10761475
6-(4,5-dihydro-1H-imidazol-2-yl)-10,10-dioxo-2-(prop-2-enylamino)thioxanthen-9-one (PubChem CID 10761475) has the molecular formula C19H17N3O3S and a molecular weight of 367.43 g/mol. Its IUPAC name is 6-(4,5-dihydro-1H-imidazol-2-yl)-10,10-dioxo-2-(prop-2-enylamino)thioxanthen-9-one.
| Compound Name | 6-(4,5-dihydro-1H-imidazol-2-yl)-10,10-dioxo-2-(prop-2-enylamino)thioxanthen-9-one |
|---|---|
| PubChem CID | 10761475 |
| Molecular Formula | C19H17N3O3S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 6-(4,5-dihydro-1H-imidazol-2-yl)-10,10-dioxo-2-(prop-2-enylamino)thioxanthen-9-one |
| SMILES | C=CCNc1ccc2c(c1)C(=O)c1ccc(C3=NCCN3)cc1S2(=O)=O |
| InChI | InChI=1S/C19H17N3O3S/c1-2-7-20-13-4-6-16-15(11-13)18(23)14-5-3-12(19-21-8-9-22-19)10-17(14)26(16,24)25/h2-6,10-11,20H,1,7-9H2,(H,21,22) |
| InChIKey | IPOXGVVGQZDCEX-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|