C13H7BrF2O2S — CID 107615051
(E)-3-[5-(4-bromo-2,5-difluorophenyl)thiophen-2-yl]prop-2-enoic acid (PubChem CID 107615051) has the molecular formula C13H7BrF2O2S and a molecular weight of 345.16 g/mol. Its IUPAC name is (E)-3-[5-(4-bromo-2,5-difluorophenyl)thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-(4-bromo-2,5-difluorophenyl)thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 107615051 |
| Molecular Formula | C13H7BrF2O2S |
| Molecular Weight | 345.16 g/mol |
| Exact Mass | 343.93 |
| IUPAC Name | (E)-3-[5-(4-bromo-2,5-difluorophenyl)thiophen-2-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(-c2cc(F)c(Br)cc2F)s1 |
| InChI | InChI=1S/C13H7BrF2O2S/c14-9-6-10(15)8(5-11(9)16)12-3-1-7(19-12)2-4-13(17)18/h1-6H,(H,17,18)/b4-2+ |
| InChIKey | DYQQRGLXXFAUKM-DUXPYHPUSA-N |
| XLogP | 4.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.16 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|