C20H13ClO5 — CID 10761566
(1S)-7-chloro-8-hydroxy-1-methyl-14-oxapentacyclo[11.6.1.02,11.04,9.016,20]icosa-2(11),3,7,9,13(20),15-hexaene-5,6,12-trione (PubChem CID 10761566) has the molecular formula C20H13ClO5 and a molecular weight of 368.77 g/mol. Its IUPAC name is (1S)-7-chloro-8-hydroxy-1-methyl-14-oxapentacyclo[11.6.1.02,11.04,9.016,20]icosa-2(11),3,7,9,13(20),15-hexaene-5,6,12-trione.
| Compound Name | (1S)-7-chloro-8-hydroxy-1-methyl-14-oxapentacyclo[11.6.1.02,11.04,9.016,20]icosa-2(11),3,7,9,13(20),15-hexaene-5,6,12-trione |
|---|---|
| PubChem CID | 10761566 |
| Molecular Formula | C20H13ClO5 |
| Molecular Weight | 368.77 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | (1S)-7-chloro-8-hydroxy-1-methyl-14-oxapentacyclo[11.6.1.02,11.04,9.016,20]icosa-2(11),3,7,9,13(20),15-hexaene-5,6,12-trione |
| SMILES | C[C@@]12CCCc3coc(c31)C(=O)c1cc3c(cc12)C(=O)C(=O)C(Cl)=C3O |
| InChI | InChI=1S/C20H13ClO5/c1-20-4-2-3-8-7-26-19(13(8)20)17(24)11-5-9-10(6-12(11)20)16(23)18(25)14(21)15(9)22/h5-7,22H,2-4H2,1H3/t20-/m0/s1 |
| InChIKey | GFSTXJGZOHAHPQ-FQEVSTJZSA-N |
| XLogP | 3.70 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.77 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|