C14H11ClFNO — CID 107616064
2-chloro-6-(2,3-dihydro-1-benzofuran-7-yl)-4-fluoroaniline (PubChem CID 107616064) has the molecular formula C14H11ClFNO and a molecular weight of 263.70 g/mol. Its IUPAC name is 2-chloro-6-(2,3-dihydro-1-benzofuran-7-yl)-4-fluoroaniline.
| Compound Name | 2-chloro-6-(2,3-dihydro-1-benzofuran-7-yl)-4-fluoroaniline |
|---|---|
| PubChem CID | 107616064 |
| Molecular Formula | C14H11ClFNO |
| Molecular Weight | 263.70 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 2-chloro-6-(2,3-dihydro-1-benzofuran-7-yl)-4-fluoroaniline |
| SMILES | Nc1c(Cl)cc(F)cc1-c1cccc2c1OCC2 |
| InChI | InChI=1S/C14H11ClFNO/c15-12-7-9(16)6-11(13(12)17)10-3-1-2-8-4-5-18-14(8)10/h1-3,6-7H,4-5,17H2 |
| InChIKey | YFWBALWVUSWDRJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.70 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|