C19H12F3N3O2 — CID 10761726
4-[[3,4-dioxo-2-[(2,2,2-trifluoro-1-phenylethyl)amino]cyclobuten-1-yl]amino]benzonitrile (PubChem CID 10761726) has the molecular formula C19H12F3N3O2 and a molecular weight of 371.32 g/mol. Its IUPAC name is 4-[[3,4-dioxo-2-[(2,2,2-trifluoro-1-phenylethyl)amino]cyclobuten-1-yl]amino]benzonitrile.
| Compound Name | 4-[[3,4-dioxo-2-[(2,2,2-trifluoro-1-phenylethyl)amino]cyclobuten-1-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 10761726 |
| Molecular Formula | C19H12F3N3O2 |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 4-[[3,4-dioxo-2-[(2,2,2-trifluoro-1-phenylethyl)amino]cyclobuten-1-yl]amino]benzonitrile |
| SMILES | N#Cc1ccc(Nc2c(NC(c3ccccc3)C(F)(F)F)c(=O)c2=O)cc1 |
| InChI | InChI=1S/C19H12F3N3O2/c20-19(21,22)18(12-4-2-1-3-5-12)25-15-14(16(26)17(15)27)24-13-8-6-11(10-23)7-9-13/h1-9,18,24-25H |
| InChIKey | LNSMYSIDVMYYTH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|