C21H27NO5 — CID 10761889
(1R,2S,6S,8R,9R,13R)-3-benzyl-11,11-dimethyl-8-prop-2-enoxy-4,10,12,14-tetraoxa-3-azatetracyclo[6.6.0.02,6.09,13]tetradecane (PubChem CID 10761889) has the molecular formula C21H27NO5 and a molecular weight of 373.45 g/mol. Its IUPAC name is (1R,2S,6S,8R,9R,13R)-3-benzyl-11,11-dimethyl-8-prop-2-enoxy-4,10,12,14-tetraoxa-3-azatetracyclo[6.6.0.02,6.09,13]tetradecane.
| Compound Name | (1R,2S,6S,8R,9R,13R)-3-benzyl-11,11-dimethyl-8-prop-2-enoxy-4,10,12,14-tetraoxa-3-azatetracyclo[6.6.0.02,6.09,13]tetradecane |
|---|---|
| PubChem CID | 10761889 |
| Molecular Formula | C21H27NO5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | (1R,2S,6S,8R,9R,13R)-3-benzyl-11,11-dimethyl-8-prop-2-enoxy-4,10,12,14-tetraoxa-3-azatetracyclo[6.6.0.02,6.09,13]tetradecane |
| SMILES | C=CCO[C@]12C[C@@H]3CON(Cc4ccccc4)[C@@H]3[C@H]1O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C21H27NO5/c1-4-10-23-21-11-15-13-24-22(12-14-8-6-5-7-9-14)16(15)17(21)25-19-18(21)26-20(2,3)27-19/h4-9,15-19H,1,10-13H2,2-3H3/t15-,16+,17-,18+,19-,21-/m1/s1 |
| InChIKey | YLLJUGHUEDDIQP-DBENCMRHSA-N |
| XLogP | 2.64 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|