C22H36O3Si — CID 10762101
(1S,3aS,7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-1-(furan-3-yl)-4,4,7a-trimethyl-3a,5,6,7-tetrahydro-1H-inden-2-ol (PubChem CID 10762101) has the molecular formula C22H36O3Si and a molecular weight of 376.61 g/mol. Its IUPAC name is (1S,3aS,7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-1-(furan-3-yl)-4,4,7a-trimethyl-3a,5,6,7-tetrahydro-1H-inden-2-ol.
| Compound Name | (1S,3aS,7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-1-(furan-3-yl)-4,4,7a-trimethyl-3a,5,6,7-tetrahydro-1H-inden-2-ol |
|---|---|
| PubChem CID | 10762101 |
| Molecular Formula | C22H36O3Si |
| Molecular Weight | 376.61 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | (1S,3aS,7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-1-(furan-3-yl)-4,4,7a-trimethyl-3a,5,6,7-tetrahydro-1H-inden-2-ol |
| SMILES | CC1(C)CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@]2(C)[C@H](c3ccoc3)C(O)=C[C@@H]12 |
| InChI | InChI=1S/C22H36O3Si/c1-20(2,3)26(7,8)25-18-9-11-21(4,5)17-13-16(23)19(22(17,18)6)15-10-12-24-14-15/h10,12-14,17-19,23H,9,11H2,1-8H3/t17-,18-,19+,22-/m0/s1 |
| InChIKey | JBZPUJAGPXUJRA-VWNVYAMZSA-N |
| XLogP | 6.65 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.61 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|