C15H22ClN3O2 — CID 107621761
N-(4-chloro-3-methoxyphenyl)-2-methyl-2-piperazin-1-ylpropanamide (PubChem CID 107621761) has the molecular formula C15H22ClN3O2 and a molecular weight of 311.81 g/mol. Its IUPAC name is N-(4-chloro-3-methoxyphenyl)-2-methyl-2-piperazin-1-ylpropanamide.
| Compound Name | N-(4-chloro-3-methoxyphenyl)-2-methyl-2-piperazin-1-ylpropanamide |
|---|---|
| PubChem CID | 107621761 |
| Molecular Formula | C15H22ClN3O2 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | N-(4-chloro-3-methoxyphenyl)-2-methyl-2-piperazin-1-ylpropanamide |
| SMILES | COc1cc(NC(=O)C(C)(C)N2CCNCC2)ccc1Cl |
| InChI | InChI=1S/C15H22ClN3O2/c1-15(2,19-8-6-17-7-9-19)14(20)18-11-4-5-12(16)13(10-11)21-3/h4-5,10,17H,6-9H2,1-3H3,(H,18,20) |
| InChIKey | DOPARYJDFBYNLH-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |