C21H37NO3Si — CID 10762291
tert-butyl N-[(2S,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylbutan-2-yl]carbamate (PubChem CID 10762291) has the molecular formula C21H37NO3Si and a molecular weight of 379.62 g/mol. Its IUPAC name is tert-butyl N-[(2S,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 10762291 |
| Molecular Formula | C21H37NO3Si |
| Molecular Weight | 379.62 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | tert-butyl N-[(2S,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylbutan-2-yl]carbamate |
| SMILES | C[C@@H](c1ccccc1)[C@@H](CO[Si](C)(C)C(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H37NO3Si/c1-16(17-13-11-10-12-14-17)18(22-19(23)25-20(2,3)4)15-24-26(8,9)21(5,6)7/h10-14,16,18H,15H2,1-9H3,(H,22,23)/t16-,18+/m0/s1 |
| InChIKey | XTTKZPCOLJQWBW-FUHWJXTLSA-N |
| XLogP | 5.71 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.62 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|